What is the formula of Glucosazone?
Identification of Glucosazone Chemical Compound
| Chemical Formula | C18H22N4O4 |
|---|---|
| Molecular Weight | 358.39168 g/mol |
| IUPAC Name | (2R,3S,4R,6E)-5,6-bis(2-phenylhydrazin-1-ylidene)hexane-1,2,3,4-tetrol |
| SMILES String | OCC(O)C(O)C(O)C(C=NNc1ccccc1)=NNc2ccccc2 |
What is a Glucosazone?
1 : the osazone of glucose, mannose, or fructose. 2 : glucose phenylosazone.
What is the formula of c6 h12 o6?
Glucose is a simple sugar with six carbon atoms and one aldehyde group. This monosaccharide has a chemical formula C6H12O6.
What is c6 h10 o5?
Diethyl pyrocarbonate is the diethyl ester of dicarbonic acid. It derives from a dicarbonic acid. ChEBI. Preservative for wines, soft drinks, and fruit juices and a gentle esterifying agent.
Where can I find the chemical formula for glucosazone?
The molecular formula of Glucosazone is available in chemical formula page of Glucosazone, which identifies each constituent element by its chemical symbol and indicates the proportionate number of atoms of each element.
What is the structure of D glucosamine 2 deoxy?
More… 2-amino-2-deoxy-D-glucopyranose is a D-glucosamine whose structure comprises D-glucopyranose having an amino substituent at position 2. It has a role as an Escherichia coli metabolite and a mouse metabolite. It derives from a D-glucopyranose. It is a conjugate base of a 2-ammonio-2-deoxy-D-glucopyranose.
How to calculate the density of specific gravity?
The density will be displayed as a specific gravity ratio in the lower text box. Formula. The conversion formula used by this tool is: SG = ρ / ρ 0. Symbols. ρ = Density of substance in kgm-3; ρ 0 = Density of pure water (1000 kgm-3 @4°C) SG = Specific gravity (e.g. pure water = 1) Density of Substance (ρ) This is the measure of the
What are the three formulas for the density?
What are the three formulas for density? To work out density: p = m / V To work out the mass: m = p x V To work out the volume: V = m / p